C26H31ClO5 — CID 11698274
(2S,3R,4R,5S)-2-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-6-cyclopentylideneoxane-3,4,5-triol (PubChem CID 11698274) has the molecular formula C26H31ClO5 and a molecular weight of 458.98 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-6-cyclopentylideneoxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-6-cyclopentylideneoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11698274 |
| Molecular Formula | C26H31ClO5 |
| Molecular Weight | 458.98 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (2S,3R,4R,5S)-2-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-6-cyclopentylideneoxane-3,4,5-triol |
| SMILES | CC(C)Oc1ccc(Cc2cc([C@@H]3OC(=C4CCCC4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H31ClO5/c1-15(2)31-20-10-7-16(8-11-20)13-19-14-18(9-12-21(19)27)26-24(30)22(28)23(29)25(32-26)17-5-3-4-6-17/h7-12,14-15,22-24,26,28-30H,3-6,13H2,1-2H3/t22-,23-,24+,26-/m0/s1 |
| InChIKey | FXSXIZHWFLCSJD-SRNFOCHHSA-N |
| XLogP | 4.70 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |