C23H25ClO6S — CID 71110650
(2S,3R,4R,5S,6R)-2-[4-chloro-5-[(4-ethoxyphenyl)methyl]-1-benzothiophen-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71110650) has the molecular formula C23H25ClO6S and a molecular weight of 464.97 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-5-[(4-ethoxyphenyl)methyl]-1-benzothiophen-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-5-[(4-ethoxyphenyl)methyl]-1-benzothiophen-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71110650 |
| Molecular Formula | C23H25ClO6S |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-5-[(4-ethoxyphenyl)methyl]-1-benzothiophen-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3sccc3c2Cl)cc1 |
| InChI | InChI=1S/C23H25ClO6S/c1-2-29-14-5-3-12(4-6-14)9-13-10-16(23-15(18(13)24)7-8-31-23)22-21(28)20(27)19(26)17(11-25)30-22/h3-8,10,17,19-22,25-28H,2,9,11H2,1H3/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | AZPHXEUMUOTBID-VOFPXKNKSA-N |
| XLogP | 3.06 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |