C24H29ClO8 — CID 163705361
(3R,4R,5S)-2-[[5-chloro-6-[(4-ethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-8-yl]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163705361) has the molecular formula C24H29ClO8 and a molecular weight of 480.94 g/mol. Its IUPAC name is (3R,4R,5S)-2-[[5-chloro-6-[(4-ethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-8-yl]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S)-2-[[5-chloro-6-[(4-ethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-8-yl]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163705361 |
| Molecular Formula | C24H29ClO8 |
| Molecular Weight | 480.94 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (3R,4R,5S)-2-[[5-chloro-6-[(4-ethoxyphenyl)methyl]-2,3-dihydro-1,4-benzodioxin-8-yl]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc(CC3OC(CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c2Cl)OCCO3)cc1 |
| InChI | InChI=1S/C24H29ClO8/c1-2-30-16-5-3-13(4-6-16)9-14-10-15(23-24(19(14)25)32-8-7-31-23)11-17-20(27)22(29)21(28)18(12-26)33-17/h3-6,10,17-18,20-22,26-29H,2,7-9,11-12H2,1H3/t17?,18?,20-,21+,22+/m0/s1 |
| InChIKey | MAAPLORSCJRXPK-GBJCSSAMSA-N |
| XLogP | 1.49 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.94 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |