C39H45NO4S — CID 58239023
2-[4-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 58239023) has the molecular formula C39H45NO4S and a molecular weight of 623.86 g/mol. Its IUPAC name is 2-[4-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 58239023 |
| Molecular Formula | C39H45NO4S |
| Molecular Weight | 623.86 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 2-[4-[[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CC[C@H]1S[C@@H](c2cccc(Cc3ccc(OCC(=O)N(C)C)cc3)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C39H45NO4S/c1-5-35-28(2)37(43-25-30-13-8-6-9-14-30)38(44-26-31-15-10-7-11-16-31)39(45-35)33-18-12-17-32(24-33)23-29-19-21-34(22-20-29)42-27-36(41)40(3)4/h6-22,24,28,35,37-39H,5,23,25-27H2,1-4H3/t28-,35-,37+,38?,39+/m1/s1 |
| InChIKey | HLTPAQYEFCVDKA-HALPDQIUSA-N |
| XLogP | 8.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.86 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |