C21H24O6S — CID 58238994
methyl 4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]phenyl]methyl]benzoate (PubChem CID 58238994) has the molecular formula C21H24O6S and a molecular weight of 404.48 g/mol. Its IUPAC name is methyl 4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]phenyl]methyl]benzoate.
| Compound Name | methyl 4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 58238994 |
| Molecular Formula | C21H24O6S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | methyl 4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)thian-2-yl]phenyl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2cccc([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C21H24O6S/c1-27-21(26)14-7-5-12(6-8-14)9-13-3-2-4-15(10-13)20-19(25)18(24)17(23)16(11-22)28-20/h2-8,10,16-20,22-25H,9,11H2,1H3/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | CJRGYLDFEKEILB-OBKDMQGPSA-N |
| XLogP | 1.30 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |