C46H47NO4S — CID 59738421
1-methyl-2-[[3-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]phenyl]methyl]pyrrole (PubChem CID 59738421) has the molecular formula C46H47NO4S and a molecular weight of 709.95 g/mol. Its IUPAC name is 1-methyl-2-[[3-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]phenyl]methyl]pyrrole.
| Compound Name | 1-methyl-2-[[3-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]phenyl]methyl]pyrrole |
|---|---|
| PubChem CID | 59738421 |
| Molecular Formula | C46H47NO4S |
| Molecular Weight | 709.95 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | 1-methyl-2-[[3-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]phenyl]methyl]pyrrole |
| SMILES | Cn1cccc1Cc1cccc([C@@H]2S[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c1 |
| InChI | InChI=1S/C46H47NO4S/c1-47-27-15-26-41(47)29-39-24-14-25-40(28-39)46-45(51-33-38-22-12-5-13-23-38)44(50-32-37-20-10-4-11-21-37)43(49-31-36-18-8-3-9-19-36)42(52-46)34-48-30-35-16-6-2-7-17-35/h2-28,42-46H,29-34H2,1H3/t42-,43-,44+,45-,46+/m1/s1 |
| InChIKey | UUBSMPHZMXZMLX-PSKPMRIASA-N |
| XLogP | 9.75 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.95 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |