C40H48O3S — CID 58239034
(2R,3S,4S,5R,6S)-2-ethyl-6-[2-methoxy-4-methyl-5-[(4-propan-2-ylphenyl)methyl]phenyl]-3-methyl-4,5-bis(phenylmethoxy)thiane (PubChem CID 58239034) has the molecular formula C40H48O3S and a molecular weight of 608.89 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-ethyl-6-[2-methoxy-4-methyl-5-[(4-propan-2-ylphenyl)methyl]phenyl]-3-methyl-4,5-bis(phenylmethoxy)thiane.
| Compound Name | (2R,3S,4S,5R,6S)-2-ethyl-6-[2-methoxy-4-methyl-5-[(4-propan-2-ylphenyl)methyl]phenyl]-3-methyl-4,5-bis(phenylmethoxy)thiane |
|---|---|
| PubChem CID | 58239034 |
| Molecular Formula | C40H48O3S |
| Molecular Weight | 608.89 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-ethyl-6-[2-methoxy-4-methyl-5-[(4-propan-2-ylphenyl)methyl]phenyl]-3-methyl-4,5-bis(phenylmethoxy)thiane |
| SMILES | CC[C@H]1S[C@@H](c2cc(Cc3ccc(C(C)C)cc3)c(C)cc2OC)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C40H48O3S/c1-7-37-29(5)38(42-25-31-14-10-8-11-15-31)39(43-26-32-16-12-9-13-17-32)40(44-37)35-24-34(28(4)22-36(35)41-6)23-30-18-20-33(21-19-30)27(2)3/h8-22,24,27,29,37-40H,7,23,25-26H2,1-6H3/t29-,37-,38+,39?,40+/m1/s1 |
| InChIKey | XXEQBBGFJJPMMY-JHYWHQBVSA-N |
| XLogP | 10.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.89 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |