C38H40O3S2 — CID 58239056
2-[[5-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]-2-methoxyphenyl]methyl]-1-benzothiophene (PubChem CID 58239056) has the molecular formula C38H40O3S2 and a molecular weight of 608.87 g/mol. Its IUPAC name is 2-[[5-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]-2-methoxyphenyl]methyl]-1-benzothiophene.
| Compound Name | 2-[[5-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]-2-methoxyphenyl]methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 58239056 |
| Molecular Formula | C38H40O3S2 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 2-[[5-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]-2-methoxyphenyl]methyl]-1-benzothiophene |
| SMILES | CC[C@H]1S[C@@H](c2ccc(OC)c(Cc3cc4ccccc4s3)c2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C38H40O3S2/c1-4-34-26(2)36(40-24-27-13-7-5-8-14-27)37(41-25-28-15-9-6-10-16-28)38(43-34)30-19-20-33(39-3)31(21-30)23-32-22-29-17-11-12-18-35(29)42-32/h5-22,26,34,36-38H,4,23-25H2,1-3H3/t26-,34-,36+,37-,38+/m1/s1 |
| InChIKey | HSZYVQUHEYAKBD-RWUUJFQVSA-N |
| XLogP | 9.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |