C50H50O4 — CID 67460237
1-ethyl-4-[[3-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]phenyl]methyl]benzene (PubChem CID 67460237) has the molecular formula C50H50O4 and a molecular weight of 714.95 g/mol. Its IUPAC name is 1-ethyl-4-[[3-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]phenyl]methyl]benzene.
| Compound Name | 1-ethyl-4-[[3-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]phenyl]methyl]benzene |
|---|---|
| PubChem CID | 67460237 |
| Molecular Formula | C50H50O4 |
| Molecular Weight | 714.95 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | 1-ethyl-4-[[3-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]phenyl]methyl]benzene |
| SMILES | CCc1ccc(Cc2cccc(C3=C[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C50H50O4/c1-2-38-26-28-39(29-27-38)30-44-24-15-25-45(31-44)47-32-46(37-51-33-40-16-7-3-8-17-40)48(52-34-41-18-9-4-10-19-41)50(54-36-43-22-13-6-14-23-43)49(47)53-35-42-20-11-5-12-21-42/h3-29,31-32,46,48-50H,2,30,33-37H2,1H3/t46-,48-,49+,50+/m1/s1 |
| InChIKey | RMUVINVOWIDRRR-SALJPSJLSA-N |
| XLogP | 10.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.95 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |