C49H47ClO5 — CID 59235334
1-chloro-2-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]-4-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]benzene (PubChem CID 59235334) has the molecular formula C49H47ClO5 and a molecular weight of 756.39 g/mol. Its IUPAC name is 1-chloro-2-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]-4-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]benzene.
| Compound Name | 1-chloro-2-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]-4-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 59235334 |
| Molecular Formula | C49H47ClO5 |
| Molecular Weight | 756.39 g/mol |
| Exact Mass | 755.34 |
| IUPAC Name | 1-chloro-2-[dideuterio-[4-(trideuteriomethoxy)phenyl]methyl]-4-[(3R,4R,5S,6S)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexen-1-yl]benzene |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C([2H])([2H])c2cc(C3=C[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C49H47ClO5/c1-51-44-25-22-36(23-26-44)28-42-29-41(24-27-46(42)50)45-30-43(35-52-31-37-14-6-2-7-15-37)47(53-32-38-16-8-3-9-17-38)49(55-34-40-20-12-5-13-21-40)48(45)54-33-39-18-10-4-11-19-39/h2-27,29-30,43,47-49H,28,31-35H2,1H3/t43-,47-,48+,49+/m1/s1/i1D3,28D2 |
| InChIKey | JYTSLPQMWLEBAF-ZRUZQPOBSA-N |
| XLogP | 10.93 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.39 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |