C48H47NO5 — CID 102166276
(2R,3'R,4R,4'S,5'R,6'R)-2-phenyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydro-1H-quinoline-4,2'-oxane] (PubChem CID 102166276) has the molecular formula C48H47NO5 and a molecular weight of 717.91 g/mol. Its IUPAC name is (2R,3'R,4R,4'S,5'R,6'R)-2-phenyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydro-1H-quinoline-4,2'-oxane].
| Compound Name | (2R,3'R,4R,4'S,5'R,6'R)-2-phenyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydro-1H-quinoline-4,2'-oxane] |
|---|---|
| PubChem CID | 102166276 |
| Molecular Formula | C48H47NO5 |
| Molecular Weight | 717.91 g/mol |
| Exact Mass | 717.35 |
| IUPAC Name | (2R,3'R,4R,4'S,5'R,6'R)-2-phenyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydro-1H-quinoline-4,2'-oxane] |
| SMILES | c1ccc(COC[C@H]2O[C@@]3(C[C@H](c4ccccc4)Nc4ccccc43)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C48H47NO5/c1-6-18-36(19-7-1)31-50-35-44-45(51-32-37-20-8-2-9-21-37)46(52-33-38-22-10-3-11-23-38)47(53-34-39-24-12-4-13-25-39)48(54-44)30-43(40-26-14-5-15-27-40)49-42-29-17-16-28-41(42)48/h1-29,43-47,49H,30-35H2/t43-,44-,45-,46+,47-,48-/m1/s1 |
| InChIKey | FRIDWYZKFDPLFS-BTINMGIUSA-N |
| XLogP | 9.81 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.91 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |