C17H19ClO — CID 123745786
1-chloro-4-methyl-2-[(4-propoxyphenyl)methyl]benzene (PubChem CID 123745786) has the molecular formula C17H19ClO and a molecular weight of 274.79 g/mol. Its IUPAC name is 1-chloro-4-methyl-2-[(4-propoxyphenyl)methyl]benzene.
| Compound Name | 1-chloro-4-methyl-2-[(4-propoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 123745786 |
| Molecular Formula | C17H19ClO |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-chloro-4-methyl-2-[(4-propoxyphenyl)methyl]benzene |
| SMILES | CCCOc1ccc(Cc2cc(C)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H19ClO/c1-3-10-19-16-7-5-14(6-8-16)12-15-11-13(2)4-9-17(15)18/h4-9,11H,3,10,12H2,1-2H3 |
| InChIKey | ORPGVRHBMQCTPO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |