C16H24ClNO4 — CID 99123969
(2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-4-methylpentanoic acid (PubChem CID 99123969) has the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. Its IUPAC name is (2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 99123969 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2S)-2-[(3-chloro-5-ethoxy-4-methoxyphenyl)methylamino]-4-methylpentanoic acid |
| SMILES | CCOc1cc(CN[C@@H](CC(C)C)C(=O)O)cc(Cl)c1OC |
| InChI | InChI=1S/C16H24ClNO4/c1-5-22-14-8-11(7-12(17)15(14)21-4)9-18-13(16(19)20)6-10(2)3/h7-8,10,13,18H,5-6,9H2,1-4H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | JYONDCJMRKDYOQ-ZDUSSCGKSA-N |
| XLogP | 3.34 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |