C16H26N2O4 — CID 94870303
N-ethyl-2-[4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 94870303) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is N-ethyl-2-[4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-ethyl-2-[4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 94870303 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-ethyl-2-[4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | CCNC(=O)COc1ccc(CN[C@@H](CC)CO)cc1OC |
| InChI | InChI=1S/C16H26N2O4/c1-4-13(10-19)18-9-12-6-7-14(15(8-12)21-3)22-11-16(20)17-5-2/h6-8,13,18-19H,4-5,9-11H2,1-3H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | GUAUYAYXTPHMFY-ZDUSSCGKSA-N |
| XLogP | 1.07 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |