C22H22BrNO3S — CID 126122638
[4-bromo-2-[(2,3-dimethylanilino)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126122638) has the molecular formula C22H22BrNO3S and a molecular weight of 460.39 g/mol. Its IUPAC name is [4-bromo-2-[(2,3-dimethylanilino)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-bromo-2-[(2,3-dimethylanilino)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126122638 |
| Molecular Formula | C22H22BrNO3S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | [4-bromo-2-[(2,3-dimethylanilino)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(Br)cc2CNc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C22H22BrNO3S/c1-15-7-10-20(11-8-15)28(25,26)27-22-12-9-19(23)13-18(22)14-24-21-6-4-5-16(2)17(21)3/h4-13,24H,14H2,1-3H3 |
| InChIKey | NKANIVRQNHDNHU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|