C20H25NO2 — CID 126121742
N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-3,4-dimethylaniline (PubChem CID 126121742) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-3,4-dimethylaniline.
| Compound Name | N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 126121742 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-3,4-dimethylaniline |
| SMILES | C=CCOc1ccc(CNc2ccc(C)c(C)c2)cc1OCC |
| InChI | InChI=1S/C20H25NO2/c1-5-11-23-19-10-8-17(13-20(19)22-6-2)14-21-18-9-7-15(3)16(4)12-18/h5,7-10,12-13,21H,1,6,11,14H2,2-4H3 |
| InChIKey | ROXNCYUQATZQEM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|