C26H30N2O4 — CID 5034754
N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(4-methoxyanilino)methyl]phenoxy]acetamide (PubChem CID 5034754) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(4-methoxyanilino)methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(4-methoxyanilino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 5034754 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[2-ethoxy-4-[(4-methoxyanilino)methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNc2ccc(OC)cc2)ccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H30N2O4/c1-5-31-25-15-20(16-27-21-9-11-23(30-4)12-10-21)7-13-24(25)32-17-26(29)28-22-8-6-18(2)19(3)14-22/h6-15,27H,5,16-17H2,1-4H3,(H,28,29) |
| InChIKey | OMWLOKNRRCXLNC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|