C18H21NO3 — CID 66525608
4-methoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]aniline (PubChem CID 66525608) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-methoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]aniline.
| Compound Name | 4-methoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 66525608 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-methoxy-N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]aniline |
| SMILES | C=CCOc1ccc(CNc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C18H21NO3/c1-4-11-22-17-10-5-14(12-18(17)21-3)13-19-15-6-8-16(20-2)9-7-15/h4-10,12,19H,1,11,13H2,2-3H3 |
| InChIKey | JDQJCYLOJHHECO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|