C19H23NO2 — CID 126120336
N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2,4-dimethylaniline (PubChem CID 126120336) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2,4-dimethylaniline.
| Compound Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 126120336 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-2,4-dimethylaniline |
| SMILES | C=CCOc1ccc(CNc2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C19H23NO2/c1-5-10-22-18-9-7-16(12-19(18)21-4)13-20-17-8-6-14(2)11-15(17)3/h5-9,11-12,20H,1,10,13H2,2-4H3 |
| InChIKey | PHRBYQDRVVKNSD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|