C16H22O2 — CID 65166948
1-(3-methylphenyl)-5-(oxolan-2-yl)pentan-2-one (PubChem CID 65166948) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(3-methylphenyl)-5-(oxolan-2-yl)pentan-2-one.
| Compound Name | 1-(3-methylphenyl)-5-(oxolan-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 65166948 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1-(3-methylphenyl)-5-(oxolan-2-yl)pentan-2-one |
| SMILES | Cc1cccc(CC(=O)CCCC2CCCO2)c1 |
| InChI | InChI=1S/C16H22O2/c1-13-5-2-6-14(11-13)12-15(17)7-3-8-16-9-4-10-18-16/h2,5-6,11,16H,3-4,7-10,12H2,1H3 |
| InChIKey | WYXOZZXNXGHMGC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |