C15H18F2O2 — CID 114976783
1-(2,3-difluorophenyl)-5-(oxolan-2-yl)pentan-2-one (PubChem CID 114976783) has the molecular formula C15H18F2O2 and a molecular weight of 268.30 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-5-(oxolan-2-yl)pentan-2-one.
| Compound Name | 1-(2,3-difluorophenyl)-5-(oxolan-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 114976783 |
| Molecular Formula | C15H18F2O2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-(2,3-difluorophenyl)-5-(oxolan-2-yl)pentan-2-one |
| SMILES | O=C(CCCC1CCCO1)Cc1cccc(F)c1F |
| InChI | InChI=1S/C15H18F2O2/c16-14-8-1-4-11(15(14)17)10-12(18)5-2-6-13-7-3-9-19-13/h1,4,8,13H,2-3,5-7,9-10H2 |
| InChIKey | MLVZRPMIFCEDKZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |