C15H17F2NO — CID 114752877
2-(2,4-difluorophenyl)-3-oxononanenitrile (PubChem CID 114752877) has the molecular formula C15H17F2NO and a molecular weight of 265.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-oxononanenitrile.
| Compound Name | 2-(2,4-difluorophenyl)-3-oxononanenitrile |
|---|---|
| PubChem CID | 114752877 |
| Molecular Formula | C15H17F2NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-oxononanenitrile |
| SMILES | CCCCCCC(=O)C(C#N)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H17F2NO/c1-2-3-4-5-6-15(19)13(10-18)12-8-7-11(16)9-14(12)17/h7-9,13H,2-6H2,1H3 |
| InChIKey | OLSFYQIRSROEJI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|