C13H16N2 — CID 43753552
2-(cyclopropylamino)-2-(3,4-dimethylphenyl)acetonitrile (PubChem CID 43753552) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-(3,4-dimethylphenyl)acetonitrile.
| Compound Name | 2-(cyclopropylamino)-2-(3,4-dimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 43753552 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-(cyclopropylamino)-2-(3,4-dimethylphenyl)acetonitrile |
| SMILES | Cc1ccc(C(C#N)NC2CC2)cc1C |
| InChI | InChI=1S/C13H16N2/c1-9-3-4-11(7-10(9)2)13(8-14)15-12-5-6-12/h3-4,7,12-13,15H,5-6H2,1-2H3 |
| InChIKey | HMADYPQSGIFPLX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |