C20H16O7 — CID 11760358
3-[1,2-bis(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-2H-furan-5-one (PubChem CID 11760358) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is 3-[1,2-bis(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-2H-furan-5-one.
| Compound Name | 3-[1,2-bis(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 11760358 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[1,2-bis(1,3-benzodioxol-5-yl)ethyl]-4-hydroxy-2H-furan-5-one |
| SMILES | O=C1OCC(C(Cc2ccc3c(c2)OCO3)c2ccc3c(c2)OCO3)=C1O |
| InChI | InChI=1S/C20H16O7/c21-19-14(8-23-20(19)22)13(12-2-4-16-18(7-12)27-10-25-16)5-11-1-3-15-17(6-11)26-9-24-15/h1-4,6-7,13,21H,5,8-10H2 |
| InChIKey | BBCFJCWAARYNFG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |