C20H23NO2 — CID 168896172
2-(1,3-benzodioxol-5-yl)-1-cyclopropyl-N-[(1R)-1-phenylethyl]ethanamine (PubChem CID 168896172) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-cyclopropyl-N-[(1R)-1-phenylethyl]ethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-cyclopropyl-N-[(1R)-1-phenylethyl]ethanamine |
|---|---|
| PubChem CID | 168896172 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-cyclopropyl-N-[(1R)-1-phenylethyl]ethanamine |
| SMILES | C[C@@H](NC(Cc1ccc2c(c1)OCO2)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-14(16-5-3-2-4-6-16)21-18(17-8-9-17)11-15-7-10-19-20(12-15)23-13-22-19/h2-7,10,12,14,17-18,21H,8-9,11,13H2,1H3/t14-,18?/m1/s1 |
| InChIKey | DAOUMAIWIZPZNJ-IKJXHCRLSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |