C22H25NO6 — CID 11711038
(Z)-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]oxy-4-oxobut-2-enoic acid;(1S)-1-phenylethanamine (PubChem CID 11711038) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is (Z)-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]oxy-4-oxobut-2-enoic acid;(1S)-1-phenylethanamine.
| Compound Name | (Z)-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]oxy-4-oxobut-2-enoic acid;(1S)-1-phenylethanamine |
|---|---|
| PubChem CID | 11711038 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (Z)-4-[(2S)-1-(1,3-benzodioxol-5-yl)propan-2-yl]oxy-4-oxobut-2-enoic acid;(1S)-1-phenylethanamine |
| SMILES | C[C@@H](Cc1ccc2c(c1)OCO2)OC(=O)/C=C\C(=O)O.C[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C14H14O6.C8H11N/c1-9(20-14(17)5-4-13(15)16)6-10-2-3-11-12(7-10)19-8-18-11;1-7(9)8-5-3-2-4-6-8/h2-5,7,9H,6,8H2,1H3,(H,15,16);2-7H,9H2,1H3/b5-4-;/t9-;7-/m00/s1 |
| InChIKey | OMLQEVDHNMSEOR-QHGVVEHWSA-N |
| XLogP | 3.24 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|