C13H14O4S — CID 22376747
S-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxopropyl] ethanethioate (PubChem CID 22376747) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is S-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxopropyl] ethanethioate.
| Compound Name | S-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 22376747 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | S-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxopropyl] ethanethioate |
| SMILES | CC(=O)SCC(C=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14O4S/c1-9(15)18-7-11(6-14)4-10-2-3-12-13(5-10)17-8-16-12/h2-3,5-6,11H,4,7-8H2,1H3 |
| InChIKey | IUBUGXHXTNDNHN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|