C23H20N2O5 — CID 1134915
[4-[(E)-3-(benzylamino)-2-(furan-2-carbonylamino)-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 1134915) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [4-[(E)-3-(benzylamino)-2-(furan-2-carbonylamino)-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [4-[(E)-3-(benzylamino)-2-(furan-2-carbonylamino)-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 1134915 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [4-[(E)-3-(benzylamino)-2-(furan-2-carbonylamino)-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C(/NC(=O)c2ccco2)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O5/c1-16(26)30-19-11-9-17(10-12-19)14-20(25-23(28)21-8-5-13-29-21)22(27)24-15-18-6-3-2-4-7-18/h2-14H,15H2,1H3,(H,24,27)(H,25,28)/b20-14+ |
| InChIKey | VNIWVCNRRUOGDM-XSFVSMFZSA-N |
| XLogP | 3.29 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|