C30H34N2O4 — CID 89206052
ethyl (2S)-2-[[4-[[(2S)-1-ethylperoxy-3-phenylpropan-2-yl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoate (PubChem CID 89206052) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is ethyl (2S)-2-[[4-[[(2S)-1-ethylperoxy-3-phenylpropan-2-yl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[4-[[(2S)-1-ethylperoxy-3-phenylpropan-2-yl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 89206052 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | ethyl (2S)-2-[[4-[[(2S)-1-ethylperoxy-3-phenylpropan-2-yl]iminomethyl]phenyl]methylideneamino]-3-phenylpropanoate |
| SMILES | CCOOC[C@H](Cc1ccccc1)/N=C/c1ccc(/C=N/[C@@H](Cc2ccccc2)C(=O)OCC)cc1 |
| InChI | InChI=1S/C30H34N2O4/c1-3-34-30(33)29(20-25-13-9-6-10-14-25)32-22-27-17-15-26(16-18-27)21-31-28(23-36-35-4-2)19-24-11-7-5-8-12-24/h5-18,21-22,28-29H,3-4,19-20,23H2,1-2H3/b31-21+,32-22+/t28-,29-/m0/s1 |
| InChIKey | JVRFAFDSLCCXEA-WTSGLCRWSA-N |
| XLogP | 5.28 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|