C18H21NO3S — CID 10592618
N-[(2,5-dimethoxyphenyl)methyl]-N-(2-phenylsulfanylethyl)formamide (PubChem CID 10592618) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-N-(2-phenylsulfanylethyl)formamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-N-(2-phenylsulfanylethyl)formamide |
|---|---|
| PubChem CID | 10592618 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-N-(2-phenylsulfanylethyl)formamide |
| SMILES | COc1ccc(OC)c(CN(C=O)CCSc2ccccc2)c1 |
| InChI | InChI=1S/C18H21NO3S/c1-21-16-8-9-18(22-2)15(12-16)13-19(14-20)10-11-23-17-6-4-3-5-7-17/h3-9,12,14H,10-11,13H2,1-2H3 |
| InChIKey | YCALEUJEWLVWPT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|