C24H32Cl2N8O16 — CID 24835878
N',N'-bis(2-chloroethyl)-N,N-diethylbutane-1,4-diamine oxide;bis(2,4,6-trinitrophenol) (PubChem CID 24835878) has the molecular formula C24H32Cl2N8O16 and a molecular weight of 759.47 g/mol. Its IUPAC name is N',N'-bis(2-chloroethyl)-N,N-diethylbutane-1,4-diamine oxide;bis(2,4,6-trinitrophenol).
| Compound Name | N',N'-bis(2-chloroethyl)-N,N-diethylbutane-1,4-diamine oxide;bis(2,4,6-trinitrophenol) |
|---|---|
| PubChem CID | 24835878 |
| Molecular Formula | C24H32Cl2N8O16 |
| Molecular Weight | 759.47 g/mol |
| Exact Mass | 758.13 |
| IUPAC Name | N',N'-bis(2-chloroethyl)-N,N-diethylbutane-1,4-diamine oxide;bis(2,4,6-trinitrophenol) |
| SMILES | CC[N+]([O-])(CC)CCCC[N+]([O-])(CCCl)CCCl.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H26Cl2N2O2.2C6H3N3O7/c1-3-15(17,4-2)9-5-6-10-16(18,11-7-13)12-8-14;2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-12H2,1-2H3;2*1-2,10H |
| InChIKey | RSBXEVWLXBWVHN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 345.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|