C18H22N4O10 — CID 16637665
N-methyl-2-(3,4,5-trimethoxyphenyl)ethanamine;2,4,6-trinitrophenol (PubChem CID 16637665) has the molecular formula C18H22N4O10 and a molecular weight of 454.39 g/mol. Its IUPAC name is N-methyl-2-(3,4,5-trimethoxyphenyl)ethanamine;2,4,6-trinitrophenol.
| Compound Name | N-methyl-2-(3,4,5-trimethoxyphenyl)ethanamine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 16637665 |
| Molecular Formula | C18H22N4O10 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-methyl-2-(3,4,5-trimethoxyphenyl)ethanamine;2,4,6-trinitrophenol |
| SMILES | CNCCc1cc(OC)c(OC)c(OC)c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H19NO3.C6H3N3O7/c1-13-6-5-9-7-10(14-2)12(16-4)11(8-9)15-3;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h7-8,13H,5-6H2,1-4H3;1-2,10H |
| InChIKey | XJXYCKZQWUGCPZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 189.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|