C17H11N3O6S — CID 15365079
4-(2,4-dinitrophenyl)sulfanyl-1-hydroxynaphthalene-2-carboxamide (PubChem CID 15365079) has the molecular formula C17H11N3O6S and a molecular weight of 385.36 g/mol. Its IUPAC name is 4-(2,4-dinitrophenyl)sulfanyl-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | 4-(2,4-dinitrophenyl)sulfanyl-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 15365079 |
| Molecular Formula | C17H11N3O6S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 4-(2,4-dinitrophenyl)sulfanyl-1-hydroxynaphthalene-2-carboxamide |
| SMILES | NC(=O)c1cc(Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccccc2c1O |
| InChI | InChI=1S/C17H11N3O6S/c18-17(22)12-8-15(10-3-1-2-4-11(10)16(12)21)27-14-6-5-9(19(23)24)7-13(14)20(25)26/h1-8,21H,(H2,18,22) |
| InChIKey | DOYRQWYTPXASEG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|