C27H25F3N2O5S — CID 98383336
N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide (PubChem CID 98383336) has the molecular formula C27H25F3N2O5S and a molecular weight of 546.57 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide.
| Compound Name | N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 98383336 |
| Molecular Formula | C27H25F3N2O5S |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | N-[(1R)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methylpropyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccccc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C27H25F3N2O5S/c1-16(2)25(17-8-10-21-22(14-17)37-13-5-12-36-21)31-26(33)19-6-3-4-7-23(19)38-24-11-9-18(27(28,29)30)15-20(24)32(34)35/h3-4,6-11,14-16,25H,5,12-13H2,1-2H3,(H,31,33)/t25-/m1/s1 |
| InChIKey | DLKBRBGTHKCPON-RUZDIDTESA-N |
| XLogP | 7.05 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|