C14H4F7NO4S — CID 2800843
2,3,5,6-tetrafluoro-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid (PubChem CID 2800843) has the molecular formula C14H4F7NO4S and a molecular weight of 415.24 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 2800843 |
| Molecular Formula | C14H4F7NO4S |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(Sc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C14H4F7NO4S/c15-8-7(13(23)24)9(16)11(18)12(10(8)17)27-6-2-1-4(14(19,20)21)3-5(6)22(25)26/h1-3H,(H,23,24) |
| InChIKey | XYHHSCJVXAKYAG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|