C23H29N5O3S — CID 46330137
1-(1-butan-2-ylbenzotriazol-5-yl)sulfonyl-N-(3-methylphenyl)piperidine-4-carboxamide (PubChem CID 46330137) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 1-(1-butan-2-ylbenzotriazol-5-yl)sulfonyl-N-(3-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-butan-2-ylbenzotriazol-5-yl)sulfonyl-N-(3-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46330137 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 1-(1-butan-2-ylbenzotriazol-5-yl)sulfonyl-N-(3-methylphenyl)piperidine-4-carboxamide |
| SMILES | CCC(C)n1nnc2cc(S(=O)(=O)N3CCC(C(=O)Nc4cccc(C)c4)CC3)ccc21 |
| InChI | InChI=1S/C23H29N5O3S/c1-4-17(3)28-22-9-8-20(15-21(22)25-26-28)32(30,31)27-12-10-18(11-13-27)23(29)24-19-7-5-6-16(2)14-19/h5-9,14-15,17-18H,4,10-13H2,1-3H3,(H,24,29) |
| InChIKey | HJPSCACPZNSONQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |