C20H21N3O4S2 — CID 124769982
(2R)-2-methyl-6-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 124769982) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (2R)-2-methyl-6-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2R)-2-methyl-6-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 124769982 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (2R)-2-methyl-6-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | C[C@H]1Sc2ccc(S(=O)(=O)N3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)cc2NC1=O |
| InChI | InChI=1S/C20H21N3O4S2/c1-12-20(25)21-16-8-15(5-6-18(16)28-12)29(26,27)22-9-13-7-14(11-22)17-3-2-4-19(24)23(17)10-13/h2-6,8,12-14H,7,9-11H2,1H3,(H,21,25)/t12-,13-,14+/m1/s1 |
| InChIKey | MLSPROIJYNGXIG-MCIONIFRSA-N |
| XLogP | 2.09 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |