C17H18N3O5S- — CID 163123091
(1S,9S)-11-[3-[hydroxy(oxido)amino]phenyl]sulfonyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 163123091) has the molecular formula C17H18N3O5S- and a molecular weight of 376.41 g/mol. Its IUPAC name is (1S,9S)-11-[3-[hydroxy(oxido)amino]phenyl]sulfonyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-[3-[hydroxy(oxido)amino]phenyl]sulfonyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 163123091 |
| Molecular Formula | C17H18N3O5S- |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (1S,9S)-11-[3-[hydroxy(oxido)amino]phenyl]sulfonyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1C[C@@H]1C[C@H]2CN(S(=O)(=O)c2cccc(N([O-])O)c2)C1 |
| InChI | InChI=1S/C17H18N3O5S/c21-17-6-2-5-16-13-7-12(10-19(16)17)9-18(11-13)26(24,25)15-4-1-3-14(8-15)20(22)23/h1-6,8,12-13,22H,7,9-11H2/q-1/t12-,13+/m1/s1 |
| InChIKey | UXIRUEHEVVISNA-OLZOCXBDSA-N |
| XLogP | 1.35 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|