C16H18N4O5S — CID 98202626
6-methyl-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-1H-pyrimidine-2,4-dione (PubChem CID 98202626) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 6-methyl-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-methyl-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 98202626 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 6-methyl-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]sulfonyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C16H18N4O5S/c1-9-14(15(22)18-16(23)17-9)26(24,25)19-6-10-5-11(8-19)12-3-2-4-13(21)20(12)7-10/h2-4,10-11H,5-8H2,1H3,(H2,17,18,22,23)/t10-,11-/m0/s1 |
| InChIKey | JOCZWQKARZPYJF-QWRGUYRKSA-N |
| XLogP | -0.66 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |