C24H25ClN2O4S2 — CID 74949311
4-chloro-N-[4-[[3-[(1-methylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzenesulfonamide (PubChem CID 74949311) has the molecular formula C24H25ClN2O4S2 and a molecular weight of 505.06 g/mol. Its IUPAC name is 4-chloro-N-[4-[[3-[(1-methylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[[3-[(1-methylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 74949311 |
| Molecular Formula | C24H25ClN2O4S2 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 4-chloro-N-[4-[[3-[(1-methylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]benzenesulfonamide |
| SMILES | CC1(CN2C(=O)SC(=Cc3ccc(NS(=O)(=O)c4ccc(Cl)cc4)cc3)C2=O)CCCCC1 |
| InChI | InChI=1S/C24H25ClN2O4S2/c1-24(13-3-2-4-14-24)16-27-22(28)21(32-23(27)29)15-17-5-9-19(10-6-17)26-33(30,31)20-11-7-18(25)8-12-20/h5-12,15,26H,2-4,13-14,16H2,1H3 |
| InChIKey | DEWVIIHDJFWMOI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|