C14H12N2O2S3 — CID 154615033
(5Z)-5-[[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154615033) has the molecular formula C14H12N2O2S3 and a molecular weight of 336.46 g/mol. Its IUPAC name is (5Z)-5-[[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154615033 |
| Molecular Formula | C14H12N2O2S3 |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (5Z)-5-[[5-[5-(dimethylamino)thiophen-2-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(-c2ccc(/C=C3\SC(=O)NC3=O)s2)s1 |
| InChI | InChI=1S/C14H12N2O2S3/c1-16(2)12-6-5-10(20-12)9-4-3-8(19-9)7-11-13(17)15-14(18)21-11/h3-7H,1-2H3,(H,15,17,18)/b11-7- |
| InChIKey | ULJCSFVCKOVDSG-XFFZJAGNSA-N |
| XLogP | 3.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|