C5H5NO2S — CID 23128889
(5E)-5-ethylidene-1,3-thiazolidine-2,4-dione (PubChem CID 23128889) has the molecular formula C5H5NO2S and a molecular weight of 143.17 g/mol. Its IUPAC name is (5E)-5-ethylidene-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-ethylidene-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23128889 |
| Molecular Formula | C5H5NO2S |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.00 |
| IUPAC Name | (5E)-5-ethylidene-1,3-thiazolidine-2,4-dione |
| SMILES | C/C=C1/SC(=O)NC1=O |
| InChI | InChI=1S/C5H5NO2S/c1-2-3-4(7)6-5(8)9-3/h2H,1H3,(H,6,7,8)/b3-2+ |
| InChIKey | IMRZMNPKDMFTBV-NSCUHMNNSA-N |
| XLogP | 0.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|