C18H15N2O2S+ — CID 90994693
5-[(9-ethylcarbazol-9-ium-9-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 90994693) has the molecular formula C18H15N2O2S+ and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-[(9-ethylcarbazol-9-ium-9-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(9-ethylcarbazol-9-ium-9-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90994693 |
| Molecular Formula | C18H15N2O2S+ |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-[(9-ethylcarbazol-9-ium-9-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC[N+]1(C=C2SC(=O)NC2=O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H14N2O2S/c1-2-20(11-16-17(21)19-18(22)23-16)14-9-5-3-7-12(14)13-8-4-6-10-15(13)20/h3-11H,2H2,1H3/p+1 |
| InChIKey | HKMWIDRVQSDGKZ-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|