C18H14N2O7S2 — CID 141245666
ethyl 2-[2-[(1Z,2Z)-1,2-bis(2,4-dioxo-1,3-thiazolidin-5-ylidene)ethyl]phenoxy]acetate (PubChem CID 141245666) has the molecular formula C18H14N2O7S2 and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 2-[2-[(1Z,2Z)-1,2-bis(2,4-dioxo-1,3-thiazolidin-5-ylidene)ethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(1Z,2Z)-1,2-bis(2,4-dioxo-1,3-thiazolidin-5-ylidene)ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 141245666 |
| Molecular Formula | C18H14N2O7S2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | ethyl 2-[2-[(1Z,2Z)-1,2-bis(2,4-dioxo-1,3-thiazolidin-5-ylidene)ethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1C(/C=C1\SC(=O)NC1=O)=C1\SC(=O)NC1=O |
| InChI | InChI=1S/C18H14N2O7S2/c1-2-26-13(21)8-27-11-6-4-3-5-9(11)10(14-16(23)20-18(25)29-14)7-12-15(22)19-17(24)28-12/h3-7H,2,8H2,1H3,(H,19,22,24)(H,20,23,25)/b12-7-,14-10- |
| InChIKey | HNURKMVIFZXUPL-TYUKFMBJSA-N |
| XLogP | 2.19 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|