C12H10N2O3S — CID 2905869
N-benzyl-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide (PubChem CID 2905869) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-benzyl-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide.
| Compound Name | N-benzyl-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
|---|---|
| PubChem CID | 2905869 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | N-benzyl-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetamide |
| SMILES | O=C(C=C1SC(=O)NC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C12H10N2O3S/c15-10(6-9-11(16)14-12(17)18-9)13-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,13,15)(H,14,16,17) |
| InChIKey | BWXNTIPQZHBNKW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|