C24H19FN2O2S — CID 3614995
N-benzyl-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide (PubChem CID 3614995) has the molecular formula C24H19FN2O2S and a molecular weight of 418.49 g/mol. Its IUPAC name is N-benzyl-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide.
| Compound Name | N-benzyl-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 3614995 |
| Molecular Formula | C24H19FN2O2S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-benzyl-2-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
| SMILES | O=C(C=C1Sc2ccccc2N(Cc2ccc(F)cc2)C1=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H19FN2O2S/c25-19-12-10-18(11-13-19)16-27-20-8-4-5-9-21(20)30-22(24(27)29)14-23(28)26-15-17-6-2-1-3-7-17/h1-14H,15-16H2,(H,26,28) |
| InChIKey | YQSYUWDJOPLWHG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|