C27H25FN2O4S — CID 46249823
(2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide (PubChem CID 46249823) has the molecular formula C27H25FN2O4S and a molecular weight of 492.57 g/mol. Its IUPAC name is (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide.
| Compound Name | (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 46249823 |
| Molecular Formula | C27H25FN2O4S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
| SMILES | COc1ccc(CCNC(=O)/C=C2\Sc3ccccc3N(Cc3ccccc3F)C2=O)cc1OC |
| InChI | InChI=1S/C27H25FN2O4S/c1-33-22-12-11-18(15-23(22)34-2)13-14-29-26(31)16-25-27(32)30(17-19-7-3-4-8-20(19)28)21-9-5-6-10-24(21)35-25/h3-12,15-16H,13-14,17H2,1-2H3,(H,29,31)/b25-16- |
| InChIKey | MEBKCBCWDZYQQX-XYGWBWBKSA-N |
| XLogP | 4.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|