C28H28N2O4S — CID 46249814
(2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide (PubChem CID 46249814) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide.
| Compound Name | (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 46249814 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (2Z)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]acetamide |
| SMILES | COc1ccc(CCNC(=O)/C=C2\Sc3ccccc3N(Cc3ccc(C)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C28H28N2O4S/c1-19-8-10-21(11-9-19)18-30-22-6-4-5-7-25(22)35-26(28(30)32)17-27(31)29-15-14-20-12-13-23(33-2)24(16-20)34-3/h4-13,16-17H,14-15,18H2,1-3H3,(H,29,31)/b26-17- |
| InChIKey | SNZAOZMPEYAORY-ONUIUJJFSA-N |
| XLogP | 4.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|