C27H25ClN2O2S — CID 93310121
(2E)-2-[4-[(2-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 93310121) has the molecular formula C27H25ClN2O2S and a molecular weight of 477.03 g/mol. Its IUPAC name is (2E)-2-[4-[(2-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | (2E)-2-[4-[(2-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 93310121 |
| Molecular Formula | C27H25ClN2O2S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (2E)-2-[4-[(2-chlorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)/C=C1/Sc2ccccc2N(Cc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C27H25ClN2O2S/c1-19(15-16-20-9-3-2-4-10-20)29-26(31)17-25-27(32)30(18-21-11-5-6-12-22(21)28)23-13-7-8-14-24(23)33-25/h2-14,17,19H,15-16,18H2,1H3,(H,29,31)/b25-17+/t19-/m0/s1 |
| InChIKey | OBYIUUKGGXHMIJ-HLNOYYKJSA-N |
| XLogP | 6.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|