C32H25F3N2O2S — CID 71959225
N-(1,2-diphenylethyl)-2-[3-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-2-ylidene]acetamide (PubChem CID 71959225) has the molecular formula C32H25F3N2O2S and a molecular weight of 558.63 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-2-[3-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-2-ylidene]acetamide.
| Compound Name | N-(1,2-diphenylethyl)-2-[3-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 71959225 |
| Molecular Formula | C32H25F3N2O2S |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-(1,2-diphenylethyl)-2-[3-oxo-4-[[3-(trifluoromethyl)phenyl]methyl]-1,4-benzothiazin-2-ylidene]acetamide |
| SMILES | O=C(C=C1Sc2ccccc2N(Cc2cccc(C(F)(F)F)c2)C1=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H25F3N2O2S/c33-32(34,35)25-15-9-12-23(18-25)21-37-27-16-7-8-17-28(27)40-29(31(37)39)20-30(38)36-26(24-13-5-2-6-14-24)19-22-10-3-1-4-11-22/h1-18,20,26H,19,21H2,(H,36,38) |
| InChIKey | VMHDVSIJQJFKKO-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|